N-CHLOROACETYL GLY
N-chloroacetylglycine
CAS: 6319-96-6
Molecular Formula: C4H6ClNO3
N-CHLOROACETYL GLY - Names and Identifiers
| Name | N-chloroacetylglycine |
| Synonyms | CLAC-GLY-OH Chloroac-Gly-OH N-CHLOROACETYL GLY Chloroacetylglycine N-chloroacetylglycine N-CHLOROACETYLGLYCINE N-Chloroacetyl glycine N-(Chloroacetyl)glycine N-ALPHA-CHLORACETYL-GLYCINE (Chloroacetylamino)acetic acid n-chloroacetylglycinecrystalline (2-CHLORO-ACETYLAMINO)-ACETIC ACID |
| CAS | 6319-96-6 |
| InChI | InChI=1/C4H6ClNO3/c5-1-3(7)6-2-4(8)9/h1-2H2,(H,6,7)(H,8,9) |
N-CHLOROACETYL GLY - Physico-chemical Properties
| Molecular Formula | C4H6ClNO3 |
| Molar Mass | 151.55 |
| Density | 1.422g/cm3 |
| Melting Point | 96-98°C |
| Boling Point | 431.6°C at 760 mmHg |
| Flash Point | 214.8°C |
| Water Solubility | almost transparency in Water |
| Vapor Presure | 1.17E-08mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 1765217 |
| Storage Condition | −20°C |
| Refractive Index | 1.486 |
| MDL | MFCD00021733 |
N-CHLOROACETYL GLY - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
N-CHLOROACETYL GLY - Introduction
N-chloroacetylglycine(N-chloroacetylglycine) is the name of a compound whose properties are described as follows:
1. Appearance: white solid or crystalline form.
2. solubility: soluble in water and some organic solvents.
3. Stability: relatively stable at room temperature, but susceptible to light, heat and moisture.
N-chloroacetylglycine have the following uses in some applications:
1. disinfectant: it is an effective disinfectant, can be used to kill bacteria, fungi and viruses.
2. medical use: it can be used to treat some infectious diseases.
3. Cosmetics: It can be used as an antibacterial agent and preservative, and is commonly used in cosmetics and personal care products.
The preparation of N-chloroacetylglycine is usually carried out by the following steps:
1. chloroacetic acid reacts with glycine to generate N-(chloroacetyl) glycine.
2. N-(chloroacetyl) glycine is neutralized with a base to generate N-chloroacetylglycine.
Regarding safety information, N-chloroacetylglycine it is relatively safe under normal use conditions, the following matters still need to be noted:
1. toxicity: high concentrations may be irritating to the respiratory system and eyes.
2. Contact: Avoid skin contact and inhalation, and use protective measures such as gloves and face masks when necessary.
3. storage: should be stored in a dry, ventilated and dark place, away from fire and combustibles.
1. Appearance: white solid or crystalline form.
2. solubility: soluble in water and some organic solvents.
3. Stability: relatively stable at room temperature, but susceptible to light, heat and moisture.
N-chloroacetylglycine have the following uses in some applications:
1. disinfectant: it is an effective disinfectant, can be used to kill bacteria, fungi and viruses.
2. medical use: it can be used to treat some infectious diseases.
3. Cosmetics: It can be used as an antibacterial agent and preservative, and is commonly used in cosmetics and personal care products.
The preparation of N-chloroacetylglycine is usually carried out by the following steps:
1. chloroacetic acid reacts with glycine to generate N-(chloroacetyl) glycine.
2. N-(chloroacetyl) glycine is neutralized with a base to generate N-chloroacetylglycine.
Regarding safety information, N-chloroacetylglycine it is relatively safe under normal use conditions, the following matters still need to be noted:
1. toxicity: high concentrations may be irritating to the respiratory system and eyes.
2. Contact: Avoid skin contact and inhalation, and use protective measures such as gloves and face masks when necessary.
3. storage: should be stored in a dry, ventilated and dark place, away from fire and combustibles.
Last Update：2024-04-09 20:02:46
Supplier List
Product Name: N-(Chloroacetyl)Glycine Visit Supplier Webpage Request for quotation
CAS: 6319-96-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6319-96-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: N-(Chloroacetyl)Glycine Visit Supplier Webpage Request for quotation
CAS: 6319-96-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6319-96-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History